About 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile
4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile (PubChem CID 122504424) has the molecular formula C18H15N5O2S
and a molecular weight of 365.42 g/mol. Its IUPAC name is 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile.
Molecular Properties
| Compound Name | 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile |
| PubChem CID | 122504424 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile |
| SMILES | N#Cc1ccc(NS(=O)(=O)NCC2c3ccccc3-c3cncn32)cc1 |
| InChI | InChI=1S/C18H15N5O2S/c19-9-13-5-7-14(8-6-13)22-26(24,25)21-11-18-16-4-2-1-3-15(16)17-10-20-12-23(17)18/h1-8,10,12,18,21-22H,11H2 |
| InChIKey | VFMKSTWBVCHRPL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile?
The IUPAC name of 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile (CID 122504424) is 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile.
What is the SMILES notation for 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile?
The canonical SMILES for 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile is N#Cc1ccc(NS(=O)(=O)NCC2c3ccccc3-c3cncn32)cc1.
What is the InChIKey of 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile?
The InChIKey is VFMKSTWBVCHRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O2S/c19-9-13-5-7-14(8-6-13)22-26(24,25)21-11-18-16-4-2-1-3-15(16)17-10-20-12-23(17)18/h1-8,10,12,18,21-22H,11H2.
What are the key properties of 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile?
4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile has a molecular weight of 365.42 g/mol, XLogP of 2.27, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile is sourced from PubChem (CID 122504424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).