C18H15N5O2S — CID 122504424
4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile (PubChem CID 122504424) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile.
| Compound Name | 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile |
|---|---|
| PubChem CID | 122504424 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-(5H-imidazo[5,1-a]isoindol-5-ylmethylsulfamoylamino)benzonitrile |
| SMILES | N#Cc1ccc(NS(=O)(=O)NCC2c3ccccc3-c3cncn32)cc1 |
| InChI | InChI=1S/C18H15N5O2S/c19-9-13-5-7-14(8-6-13)22-26(24,25)21-11-18-16-4-2-1-3-15(16)17-10-20-12-23(17)18/h1-8,10,12,18,21-22H,11H2 |
| InChIKey | VFMKSTWBVCHRPL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |