C29H27N5O2 — CID 122498942
1-(4-cyanophenyl)-3-[8-[(1S)-1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-5-tricyclo[3.3.1.02,7]non-2-enyl]urea (PubChem CID 122498942) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[8-[(1S)-1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-5-tricyclo[3.3.1.02,7]non-2-enyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[8-[(1S)-1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-5-tricyclo[3.3.1.02,7]non-2-enyl]urea |
|---|---|
| PubChem CID | 122498942 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[8-[(1S)-1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-5-tricyclo[3.3.1.02,7]non-2-enyl]urea |
| SMILES | N#Cc1ccc(NC(=O)NC23CC=C4C(C2)C([C@@H](O)CC2c5ccccc5-c5cncn52)C4C3)cc1 |
| InChI | InChI=1S/C29H27N5O2/c30-14-17-5-7-18(8-6-17)32-28(36)33-29-10-9-19-22(12-29)27(23(19)13-29)26(35)11-24-20-3-1-2-4-21(20)25-15-31-16-34(24)25/h1-9,15-16,22-24,26-27,35H,10-13H2,(H2,32,33,36)/t22?,23?,24?,26-,27?,29?/m0/s1 |
| InChIKey | XPYZQZRLGSYKSG-YGPCEGLXSA-N |
| XLogP | 4.62 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|