C29H33N5O2 — CID 134195315
1-(4-aminophenyl)-3-[5-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-2-adamantyl]urea (PubChem CID 134195315) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[5-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-2-adamantyl]urea.
| Compound Name | 1-(4-aminophenyl)-3-[5-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-2-adamantyl]urea |
|---|---|
| PubChem CID | 134195315 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 1-(4-aminophenyl)-3-[5-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]-2-adamantyl]urea |
| SMILES | Nc1ccc(NC(=O)NC2C3CC4CC2CC(C(O)CC2c5ccccc5-c5cncn52)(C4)C3)cc1 |
| InChI | InChI=1S/C29H33N5O2/c30-20-5-7-21(8-6-20)32-28(36)33-27-18-9-17-10-19(27)14-29(12-17,13-18)26(35)11-24-22-3-1-2-4-23(22)25-15-31-16-34(24)25/h1-8,15-19,24,26-27,35H,9-14,30H2,(H2,32,33,36) |
| InChIKey | ULEQDZPFHOYCDZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|