C37H48N4O2 — CID 134204487
1-[4-[8-hydroxy-9-(5H-imidazo[5,1-a]isoindol-5-yl)nonyl]-1-adamantyl]-3-(4-methylphenyl)urea (PubChem CID 134204487) has the molecular formula C37H48N4O2 and a molecular weight of 580.82 g/mol. Its IUPAC name is 1-[4-[8-hydroxy-9-(5H-imidazo[5,1-a]isoindol-5-yl)nonyl]-1-adamantyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[4-[8-hydroxy-9-(5H-imidazo[5,1-a]isoindol-5-yl)nonyl]-1-adamantyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 134204487 |
| Molecular Formula | C37H48N4O2 |
| Molecular Weight | 580.82 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | 1-[4-[8-hydroxy-9-(5H-imidazo[5,1-a]isoindol-5-yl)nonyl]-1-adamantyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC23CC4CC(C2)C(CCCCCCCC(O)CC2c5ccccc5-c5cncn52)C(C4)C3)cc1 |
| InChI | InChI=1S/C37H48N4O2/c1-25-13-15-29(16-14-25)39-36(43)40-37-20-26-17-27(21-37)31(28(18-26)22-37)10-6-4-2-3-5-9-30(42)19-34-32-11-7-8-12-33(32)35-23-38-24-41(34)35/h7-8,11-16,23-24,26-28,30-31,34,42H,2-6,9-10,17-22H2,1H3,(H2,39,40,43) |
| InChIKey | LNWZHMUPJQUQMO-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.82 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|