C24H18FN3O — CID 145351905
3-(4-fluorophenyl)-N-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)benzamide (PubChem CID 145351905) has the molecular formula C24H18FN3O and a molecular weight of 383.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)benzamide.
| Compound Name | 3-(4-fluorophenyl)-N-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 145351905 |
| Molecular Formula | C24H18FN3O |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(5H-imidazo[5,1-a]isoindol-5-ylmethyl)benzamide |
| SMILES | O=C(NCC1c2ccccc2-c2cncn21)c1cccc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H18FN3O/c25-19-10-8-16(9-11-19)17-4-3-5-18(12-17)24(29)27-14-23-21-7-2-1-6-20(21)22-13-26-15-28(22)23/h1-13,15,23H,14H2,(H,27,29) |
| InChIKey | KYHHBGYHNNCUGG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |