C21H23N3O3 — CID 123583604
6-[1-[4-(1,3-dioxan-5-yloxy)phenyl]pyrrolidin-2-yl]-1H-benzimidazole (PubChem CID 123583604) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 6-[1-[4-(1,3-dioxan-5-yloxy)phenyl]pyrrolidin-2-yl]-1H-benzimidazole.
| Compound Name | 6-[1-[4-(1,3-dioxan-5-yloxy)phenyl]pyrrolidin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 123583604 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 6-[1-[4-(1,3-dioxan-5-yloxy)phenyl]pyrrolidin-2-yl]-1H-benzimidazole |
| SMILES | c1nc2ccc(C3CCCN3c3ccc(OC4COCOC4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C21H23N3O3/c1-2-21(15-3-8-19-20(10-15)23-13-22-19)24(9-1)16-4-6-17(7-5-16)27-18-11-25-14-26-12-18/h3-8,10,13,18,21H,1-2,9,11-12,14H2,(H,22,23) |
| InChIKey | UOJIDAYNHCJYFY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|