C22H22F4N4 — CID 123606424
6-[1-(2,3,5,6-tetrafluoro-4-piperidin-1-ylphenyl)pyrrolidin-2-yl]-1H-benzimidazole (PubChem CID 123606424) has the molecular formula C22H22F4N4 and a molecular weight of 418.44 g/mol. Its IUPAC name is 6-[1-(2,3,5,6-tetrafluoro-4-piperidin-1-ylphenyl)pyrrolidin-2-yl]-1H-benzimidazole.
| Compound Name | 6-[1-(2,3,5,6-tetrafluoro-4-piperidin-1-ylphenyl)pyrrolidin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 123606424 |
| Molecular Formula | C22H22F4N4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 6-[1-(2,3,5,6-tetrafluoro-4-piperidin-1-ylphenyl)pyrrolidin-2-yl]-1H-benzimidazole |
| SMILES | Fc1c(F)c(N2CCCC2c2ccc3nc[nH]c3c2)c(F)c(F)c1N1CCCCC1 |
| InChI | InChI=1S/C22H22F4N4/c23-17-19(25)22(20(26)18(24)21(17)29-8-2-1-3-9-29)30-10-4-5-16(30)13-6-7-14-15(11-13)28-12-27-14/h6-7,11-12,16H,1-5,8-10H2,(H,27,28) |
| InChIKey | VJEKRRSHSHCJIY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|