C20H17B2N3O — CID 123584334
CID 123584334 (PubChem CID 123584334) has the molecular formula C20H17B2N3O and a molecular weight of 337.00 g/mol.
| Compound Name | CID 123584334 |
|---|---|
| PubChem CID | 123584334 |
| Molecular Formula | C20H17B2N3O |
| Molecular Weight | 337.00 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c1cc([B])ccc1n2CC(O)CNc1ccccn1 |
| InChI | InChI=1S/C20H17B2N3O/c21-13-4-6-18-16(9-13)17-10-14(22)5-7-19(17)25(18)12-15(26)11-24-20-3-1-2-8-23-20/h1-10,15,26H,11-12H2,(H,23,24) |
| InChIKey | SLTXWLDVEBGLNW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.00 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|