C13H16F2N4O — CID 123584834
5-(1-butan-2-ylpyrazol-3-yl)-3-(difluoromethoxy)pyridin-2-amine (PubChem CID 123584834) has the molecular formula C13H16F2N4O and a molecular weight of 282.29 g/mol. Its IUPAC name is 5-(1-butan-2-ylpyrazol-3-yl)-3-(difluoromethoxy)pyridin-2-amine.
| Compound Name | 5-(1-butan-2-ylpyrazol-3-yl)-3-(difluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 123584834 |
| Molecular Formula | C13H16F2N4O |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5-(1-butan-2-ylpyrazol-3-yl)-3-(difluoromethoxy)pyridin-2-amine |
| SMILES | CCC(C)n1ccc(-c2cnc(N)c(OC(F)F)c2)n1 |
| InChI | InChI=1S/C13H16F2N4O/c1-3-8(2)19-5-4-10(18-19)9-6-11(20-13(14)15)12(16)17-7-9/h4-8,13H,3H2,1-2H3,(H2,16,17) |
| InChIKey | KRYUWHLWTZXISP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |