C8H10N2O2 — CID 123585137
N,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 123585137) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is N,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123585137 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | N,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(C)[nH]c1=O |
| InChI | InChI=1S/C8H10N2O2/c1-5-3-4-6(7(11)9-2)8(12)10-5/h3-4H,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | ICUAHHUWSZCTGT-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |