C7H12Cl2N2O — CID 86811591
3-(aminomethyl)-6-methyl-1H-pyridin-2-one;dihydrochloride (PubChem CID 86811591) has the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. Its IUPAC name is 3-(aminomethyl)-6-methyl-1H-pyridin-2-one;dihydrochloride.
| Compound Name | 3-(aminomethyl)-6-methyl-1H-pyridin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 86811591 |
| Molecular Formula | C7H12Cl2N2O |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 3-(aminomethyl)-6-methyl-1H-pyridin-2-one;dihydrochloride |
| SMILES | Cc1ccc(CN)c(=O)[nH]1.Cl.Cl |
| InChI | InChI=1S/C7H10N2O.2ClH/c1-5-2-3-6(4-8)7(10)9-5;;/h2-3H,4,8H2,1H3,(H,9,10);2*1H |
| InChIKey | RPDRGVCSWMXVQB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |