About 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride
3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride (PubChem CID 43810451) has the molecular formula C8H13ClN2O
and a molecular weight of 188.66 g/mol. Its IUPAC name is 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride |
| PubChem CID | 43810451 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride |
| SMILES | Cc1cc(C)c(CN)c(=O)[nH]1.Cl |
| InChI | InChI=1S/C8H12N2O.ClH/c1-5-3-6(2)10-8(11)7(5)4-9;/h3H,4,9H2,1-2H3,(H,10,11);1H |
| InChIKey | ZMDPNGUJHPRAMG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride?
The IUPAC name of 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride (CID 43810451) is 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride.
What is the SMILES notation for 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride?
The canonical SMILES for 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride is Cc1cc(C)c(CN)c(=O)[nH]1.Cl.
What is the InChIKey of 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride?
The InChIKey is ZMDPNGUJHPRAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O.ClH/c1-5-3-6(2)10-8(11)7(5)4-9;/h3H,4,9H2,1-2H3,(H,10,11);1H.
What are the key properties of 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride?
3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride has a molecular weight of 188.66 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride is sourced from PubChem (CID 43810451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).