C12H13BrNO2+ — CID 123586033
1-[(3-bromo-4-methoxyphenyl)methyl]-3,4-dihydro-2H-pyrrol-4-ylium-5-one (PubChem CID 123586033) has the molecular formula C12H13BrNO2+ and a molecular weight of 283.14 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-3,4-dihydro-2H-pyrrol-4-ylium-5-one.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-3,4-dihydro-2H-pyrrol-4-ylium-5-one |
|---|---|
| PubChem CID | 123586033 |
| Molecular Formula | C12H13BrNO2+ |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-3,4-dihydro-2H-pyrrol-4-ylium-5-one |
| SMILES | COc1ccc(CN2CC[CH+]C2=O)cc1Br |
| InChI | InChI=1S/C12H13BrNO2/c1-16-11-5-4-9(7-10(11)13)8-14-6-2-3-12(14)15/h3-5,7H,2,6,8H2,1H3/q+1 |
| InChIKey | FCVBCSSLFXBSTK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|