C16H22BrNO2 — CID 65284291
1-[(3-bromo-4-methoxyphenyl)methyl]-5,5-dimethylazepan-2-one (PubChem CID 65284291) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-5,5-dimethylazepan-2-one.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-5,5-dimethylazepan-2-one |
|---|---|
| PubChem CID | 65284291 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-5,5-dimethylazepan-2-one |
| SMILES | COc1ccc(CN2CCC(C)(C)CCC2=O)cc1Br |
| InChI | InChI=1S/C16H22BrNO2/c1-16(2)7-6-15(19)18(9-8-16)11-12-4-5-14(20-3)13(17)10-12/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | ACFSQABTKJRVCQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |