C17H19N5O — CID 123586103
8-amino-6-(2-aminopyrimidin-5-yl)-2,7-diethylisoquinolin-1-one (PubChem CID 123586103) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 8-amino-6-(2-aminopyrimidin-5-yl)-2,7-diethylisoquinolin-1-one.
| Compound Name | 8-amino-6-(2-aminopyrimidin-5-yl)-2,7-diethylisoquinolin-1-one |
|---|---|
| PubChem CID | 123586103 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 8-amino-6-(2-aminopyrimidin-5-yl)-2,7-diethylisoquinolin-1-one |
| SMILES | CCc1c(-c2cnc(N)nc2)cc2ccn(CC)c(=O)c2c1N |
| InChI | InChI=1S/C17H19N5O/c1-3-12-13(11-8-20-17(19)21-9-11)7-10-5-6-22(4-2)16(23)14(10)15(12)18/h5-9H,3-4,18H2,1-2H3,(H2,19,20,21) |
| InChIKey | NVAZKLVHCNVFNC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|