C23H24N6O3 — CID 66888226
6-(2-aminopyrimidin-5-yl)-8-(3-methoxyanilino)-2-(3-methoxypropyl)-2,7-naphthyridin-1-one (PubChem CID 66888226) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 6-(2-aminopyrimidin-5-yl)-8-(3-methoxyanilino)-2-(3-methoxypropyl)-2,7-naphthyridin-1-one.
| Compound Name | 6-(2-aminopyrimidin-5-yl)-8-(3-methoxyanilino)-2-(3-methoxypropyl)-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 66888226 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 6-(2-aminopyrimidin-5-yl)-8-(3-methoxyanilino)-2-(3-methoxypropyl)-2,7-naphthyridin-1-one |
| SMILES | COCCCn1ccc2cc(-c3cnc(N)nc3)nc(Nc3cccc(OC)c3)c2c1=O |
| InChI | InChI=1S/C23H24N6O3/c1-31-10-4-8-29-9-7-15-11-19(16-13-25-23(24)26-14-16)28-21(20(15)22(29)30)27-17-5-3-6-18(12-17)32-2/h3,5-7,9,11-14H,4,8,10H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | CPHUYLUKFWSXOV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|