C58H55N2S2+ — CID 123586235
9-[4-[5-(4-butylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]thiophen-2-yl]-5,6,6-triethyl-2-phenyl-5H-[1,3]thiazolo[2,3-a]isoquinolin-4-ium (PubChem CID 123586235) has the molecular formula C58H55N2S2+ and a molecular weight of 844.23 g/mol. Its IUPAC name is 9-[4-[5-(4-butylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]thiophen-2-yl]-5,6,6-triethyl-2-phenyl-5H-[1,3]thiazolo[2,3-a]isoquinolin-4-ium.
| Compound Name | 9-[4-[5-(4-butylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]thiophen-2-yl]-5,6,6-triethyl-2-phenyl-5H-[1,3]thiazolo[2,3-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123586235 |
| Molecular Formula | C58H55N2S2+ |
| Molecular Weight | 844.23 g/mol |
| Exact Mass | 843.38 |
| IUPAC Name | 9-[4-[5-(4-butylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]thiophen-2-yl]-5,6,6-triethyl-2-phenyl-5H-[1,3]thiazolo[2,3-a]isoquinolin-4-ium |
| SMILES | CCCCc1ccc(-n2c3ccc(-c4csc(-c5ccc6c(c5)-c5sc(-c7ccccc7)c[n+]5C(CC)C6(CC)CC)c4)cc3c3cc4c(cc32)C(C)(C)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C58H55N2S2/c1-7-11-17-37-22-26-42(27-23-37)60-51-29-25-39(30-45(51)46-33-44-43-20-15-16-21-48(43)57(5,6)50(44)34-52(46)60)41-32-53(61-36-41)40-24-28-49-47(31-40)56-59(55(8-2)58(49,9-3)10-4)35-54(62-56)38-18-13-12-14-19-38/h12-16,18-36,55H,7-11,17H2,1-6H3/q+1 |
| InChIKey | QNHHTBHIEUISOT-UHFFFAOYSA-N |
| XLogP | 16.53 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.23 |
| LogP ≤ 5 | 16.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|