C31H28ClN7O2 — CID 123586620
3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-[2-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]-3-phenylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 123586620) has the molecular formula C31H28ClN7O2 and a molecular weight of 566.07 g/mol. Its IUPAC name is 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-[2-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]-3-phenylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-[2-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]-3-phenylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123586620 |
| Molecular Formula | C31H28ClN7O2 |
| Molecular Weight | 566.07 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-[2-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]-3-phenylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1cccc(-c2cnc(C3C(c4ccccc4)CCCN3C(=O)C=Cc3cc(Cl)ccc3-n3cnnn3)[nH]2)c1 |
| InChI | InChI=1S/C31H28ClN7O2/c1-41-25-10-5-9-22(18-25)27-19-33-31(35-27)30-26(21-7-3-2-4-8-21)11-6-16-38(30)29(40)15-12-23-17-24(32)13-14-28(23)39-20-34-36-37-39/h2-5,7-10,12-15,17-20,26,30H,6,11,16H2,1H3,(H,33,35) |
| InChIKey | RXVZKDNMIGTRTP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.07 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|