C30H25Cl2N7O — CID 123852146
1-[2-[5-(4-chlorophenyl)-1H-imidazol-2-yl]-3-phenylpiperidin-1-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-en-1-one (PubChem CID 123852146) has the molecular formula C30H25Cl2N7O and a molecular weight of 570.48 g/mol. Its IUPAC name is 1-[2-[5-(4-chlorophenyl)-1H-imidazol-2-yl]-3-phenylpiperidin-1-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 1-[2-[5-(4-chlorophenyl)-1H-imidazol-2-yl]-3-phenylpiperidin-1-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123852146 |
| Molecular Formula | C30H25Cl2N7O |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 1-[2-[5-(4-chlorophenyl)-1H-imidazol-2-yl]-3-phenylpiperidin-1-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(Cl)ccc1-n1cnnn1)N1CCCC(c2ccccc2)C1c1ncc(-c2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C30H25Cl2N7O/c31-23-11-8-21(9-12-23)26-18-33-30(35-26)29-25(20-5-2-1-3-6-20)7-4-16-38(29)28(40)15-10-22-17-24(32)13-14-27(22)39-19-34-36-37-39/h1-3,5-6,8-15,17-19,25,29H,4,7,16H2,(H,33,35) |
| InChIKey | NFWNUDWSUFNCNU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|