C30H32ClN5O4 — CID 160756403
4-[2-[1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-3-cyclohexylpiperidin-2-yl]-2-oxoethyl]benzoic acid (PubChem CID 160756403) has the molecular formula C30H32ClN5O4 and a molecular weight of 562.07 g/mol. Its IUPAC name is 4-[2-[1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-3-cyclohexylpiperidin-2-yl]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-3-cyclohexylpiperidin-2-yl]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 160756403 |
| Molecular Formula | C30H32ClN5O4 |
| Molecular Weight | 562.07 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | 4-[2-[1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-3-cyclohexylpiperidin-2-yl]-2-oxoethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(=O)C2C(C3CCCCC3)CCCN2C(=O)/C=C/c2cc(Cl)ccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C30H32ClN5O4/c31-24-13-14-26(36-19-32-33-34-36)23(18-24)12-15-28(38)35-16-4-7-25(21-5-2-1-3-6-21)29(35)27(37)17-20-8-10-22(11-9-20)30(39)40/h8-15,18-19,21,25,29H,1-7,16-17H2,(H,39,40)/b15-12+ |
| InChIKey | WQYBUCQSPYSVCW-NTCAYCPXSA-N |
| XLogP | 5.03 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.07 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|