C27H21ClN6O4 — CID 78108303
4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]benzoic acid (PubChem CID 78108303) has the molecular formula C27H21ClN6O4 and a molecular weight of 528.96 g/mol. Its IUPAC name is 4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 78108303 |
| Molecular Formula | C27H21ClN6O4 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2Cc3ccccc3CN2C(=O)C=Cc2cc(Cl)ccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C27H21ClN6O4/c28-21-8-11-23(34-16-29-31-32-34)19(13-21)7-12-25(35)33-15-20-4-2-1-3-18(20)14-24(33)26(36)30-22-9-5-17(6-10-22)27(37)38/h1-13,16,24H,14-15H2,(H,30,36)(H,37,38) |
| InChIKey | QALFXTKJFREAKA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|