C30H27ClN6O6 — CID 78108443
4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-6-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]benzoic acid (PubChem CID 78108443) has the molecular formula C30H27ClN6O6 and a molecular weight of 603.04 g/mol. Its IUPAC name is 4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-6-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-6-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 78108443 |
| Molecular Formula | C30H27ClN6O6 |
| Molecular Weight | 603.04 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | 4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-6-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]benzoic acid |
| SMILES | COCCOc1ccc2c(c1)CCN(C(=O)C=Cc1cc(Cl)ccc1-n1cnnn1)C2C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H27ClN6O6/c1-42-14-15-43-24-8-9-25-20(17-24)12-13-36(28(25)29(39)33-23-6-2-19(3-7-23)30(40)41)27(38)11-4-21-16-22(31)5-10-26(21)37-18-32-34-35-37/h2-11,16-18,28H,12-15H2,1H3,(H,33,39)(H,40,41) |
| InChIKey | GVQIGVXVWBEQBR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.04 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|