C21H17ClN6O6 — CID 59402175
4-[[(2S)-3-carboxy-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]propanoyl]amino]benzoic acid (PubChem CID 59402175) has the molecular formula C21H17ClN6O6 and a molecular weight of 484.86 g/mol. Its IUPAC name is 4-[[(2S)-3-carboxy-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-3-carboxy-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 59402175 |
| Molecular Formula | C21H17ClN6O6 |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 4-[[(2S)-3-carboxy-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]propanoyl]amino]benzoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)/C=C/c1cc(Cl)ccc1-n1cnnn1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H17ClN6O6/c22-14-4-7-17(28-11-23-26-27-28)13(9-14)3-8-18(29)25-16(10-19(30)31)20(32)24-15-5-1-12(2-6-15)21(33)34/h1-9,11,16H,10H2,(H,24,32)(H,25,29)(H,30,31)(H,33,34)/b8-3+/t16-/m0/s1 |
| InChIKey | RODHDNAJXSCYJK-ICFOYXHFSA-N |
| XLogP | 1.63 |
| TPSA | 176.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|