C29H32ClN7O7 — CID 59401972
4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-[3-(2-ethoxyethoxy)pyrrolidin-1-yl]-4-oxobutanoyl]amino]benzoic acid (PubChem CID 59401972) has the molecular formula C29H32ClN7O7 and a molecular weight of 626.07 g/mol. Its IUPAC name is 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-[3-(2-ethoxyethoxy)pyrrolidin-1-yl]-4-oxobutanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-[3-(2-ethoxyethoxy)pyrrolidin-1-yl]-4-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 59401972 |
| Molecular Formula | C29H32ClN7O7 |
| Molecular Weight | 626.07 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-[3-(2-ethoxyethoxy)pyrrolidin-1-yl]-4-oxobutanoyl]amino]benzoic acid |
| SMILES | CCOCCOC1CCN(C(=O)C[C@H](NC(=O)/C=C/c2cc(Cl)ccc2-n2cnnn2)C(=O)Nc2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C29H32ClN7O7/c1-2-43-13-14-44-23-11-12-36(17-23)27(39)16-24(28(40)32-22-7-3-19(4-8-22)29(41)42)33-26(38)10-5-20-15-21(30)6-9-25(20)37-18-31-34-35-37/h3-10,15,18,23-24H,2,11-14,16-17H2,1H3,(H,32,40)(H,33,38)(H,41,42)/b10-5+/t23?,24-/m0/s1 |
| InChIKey | RZTWOGBJICJTMH-YIFWYJGPSA-N |
| XLogP | 2.19 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.07 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|