C24H24ClN7O4 — CID 90908173
4-[[(2S)-2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-2-piperidin-3-ylacetyl]amino]benzoic acid (PubChem CID 90908173) has the molecular formula C24H24ClN7O4 and a molecular weight of 509.95 g/mol. Its IUPAC name is 4-[[(2S)-2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-2-piperidin-3-ylacetyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-2-piperidin-3-ylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 90908173 |
| Molecular Formula | C24H24ClN7O4 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-[[(2S)-2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-2-piperidin-3-ylacetyl]amino]benzoic acid |
| SMILES | O=C(C=Cc1cc(Cl)ccc1-n1cnnn1)N[C@H](C(=O)Nc1ccc(C(=O)O)cc1)C1CCCNC1 |
| InChI | InChI=1S/C24H24ClN7O4/c25-18-6-9-20(32-14-27-30-31-32)16(12-18)5-10-21(33)29-22(17-2-1-11-26-13-17)23(34)28-19-7-3-15(4-8-19)24(35)36/h3-10,12,14,17,22,26H,1-2,11,13H2,(H,28,34)(H,29,33)(H,35,36)/t17?,22-/m0/s1 |
| InChIKey | RGPXSCCFAZNTCC-UGNFMNBCSA-N |
| XLogP | 2.15 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|