C25H20ClN7O5 — CID 59402161
4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-(1-oxidopyridin-1-ium-4-yl)propanoyl]amino]benzoic acid (PubChem CID 59402161) has the molecular formula C25H20ClN7O5 and a molecular weight of 533.93 g/mol. Its IUPAC name is 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-(1-oxidopyridin-1-ium-4-yl)propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-(1-oxidopyridin-1-ium-4-yl)propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 59402161 |
| Molecular Formula | C25H20ClN7O5 |
| Molecular Weight | 533.93 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-(1-oxidopyridin-1-ium-4-yl)propanoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1-n1cnnn1)N[C@@H](Cc1cc[n+]([O-])cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H20ClN7O5/c26-19-4-7-22(33-15-27-30-31-33)18(14-19)3-8-23(34)29-21(13-16-9-11-32(38)12-10-16)24(35)28-20-5-1-17(2-6-20)25(36)37/h1-12,14-15,21H,13H2,(H,28,35)(H,29,34)(H,36,37)/b8-3+/t21-/m0/s1 |
| InChIKey | SIFDRDLTJIYGIJ-OYCQWZNWSA-N |
| XLogP | 2.03 |
| TPSA | 166.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.93 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|