C26H23ClN8O3 — CID 59402128
(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-N-[4-(N'-hydroxycarbamimidoyl)phenyl]-3-phenylpropanamide (PubChem CID 59402128) has the molecular formula C26H23ClN8O3 and a molecular weight of 530.98 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-N-[4-(N'-hydroxycarbamimidoyl)phenyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-N-[4-(N'-hydroxycarbamimidoyl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 59402128 |
| Molecular Formula | C26H23ClN8O3 |
| Molecular Weight | 530.98 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-N-[4-(N'-hydroxycarbamimidoyl)phenyl]-3-phenylpropanamide |
| SMILES | NC(=NO)c1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)/C=C/c2cc(Cl)ccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C26H23ClN8O3/c27-20-9-12-23(35-16-29-33-34-35)19(15-20)8-13-24(36)31-22(14-17-4-2-1-3-5-17)26(37)30-21-10-6-18(7-11-21)25(28)32-38/h1-13,15-16,22,38H,14H2,(H2,28,32)(H,30,37)(H,31,36)/b13-8+/t22-/m0/s1 |
| InChIKey | XQVAWEXAPGHRKJ-SYZXBLONSA-N |
| XLogP | 2.79 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.98 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|