C37H44ClN7O4 — CID 59402238
3-(dibutylamino)propyl 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]benzoate (PubChem CID 59402238) has the molecular formula C37H44ClN7O4 and a molecular weight of 686.26 g/mol. Its IUPAC name is 3-(dibutylamino)propyl 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]benzoate.
| Compound Name | 3-(dibutylamino)propyl 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 59402238 |
| Molecular Formula | C37H44ClN7O4 |
| Molecular Weight | 686.26 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | 3-(dibutylamino)propyl 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]benzoate |
| SMILES | CCCCN(CCCC)CCCOC(=O)c1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)/C=C/c2cc(Cl)ccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C37H44ClN7O4/c1-3-5-21-44(22-6-4-2)23-10-24-49-37(48)29-13-17-32(18-14-29)40-36(47)33(25-28-11-8-7-9-12-28)41-35(46)20-15-30-26-31(38)16-19-34(30)45-27-39-42-43-45/h7-9,11-20,26-27,33H,3-6,10,21-25H2,1-2H3,(H,40,47)(H,41,46)/b20-15+/t33-/m0/s1 |
| InChIKey | YCESVJBRSMFUQB-FONQCXKLSA-N |
| XLogP | 6.14 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.26 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|