C30H30N6O4 — CID 89048197
ethyl 2-[4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetate (PubChem CID 89048197) has the molecular formula C30H30N6O4 and a molecular weight of 538.61 g/mol. Its IUPAC name is ethyl 2-[4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 89048197 |
| Molecular Formula | C30H30N6O4 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | ethyl 2-[4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)/C=C/c2cc(C)ccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C30H30N6O4/c1-3-40-29(38)19-23-10-13-25(14-11-23)32-30(39)26(18-22-7-5-4-6-8-22)33-28(37)16-12-24-17-21(2)9-15-27(24)36-20-31-34-35-36/h4-17,20,26H,3,18-19H2,1-2H3,(H,32,39)(H,33,37)/b16-12+/t26-/m0/s1 |
| InChIKey | XFKOKGHHJHGNFC-GDOIVROOSA-N |
| XLogP | 3.46 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|