C30H30ClN6O7P — CID 90738580
2-dimethoxyphosphorylethyl 4-[[(2S)-2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-phenylpropanoyl]amino]benzoate (PubChem CID 90738580) has the molecular formula C30H30ClN6O7P and a molecular weight of 653.03 g/mol. Its IUPAC name is 2-dimethoxyphosphorylethyl 4-[[(2S)-2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-phenylpropanoyl]amino]benzoate.
| Compound Name | 2-dimethoxyphosphorylethyl 4-[[(2S)-2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-phenylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 90738580 |
| Molecular Formula | C30H30ClN6O7P |
| Molecular Weight | 653.03 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | 2-dimethoxyphosphorylethyl 4-[[(2S)-2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-phenylpropanoyl]amino]benzoate |
| SMILES | COP(=O)(CCOC(=O)c1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)C=Cc2cc(Cl)ccc2-n2cnnn2)cc1)OC |
| InChI | InChI=1S/C30H30ClN6O7P/c1-42-45(41,43-2)17-16-44-30(40)22-8-12-25(13-9-22)33-29(39)26(18-21-6-4-3-5-7-21)34-28(38)15-10-23-19-24(31)11-14-27(23)37-20-32-35-36-37/h3-15,19-20,26H,16-18H2,1-2H3,(H,33,39)(H,34,38)/t26-/m0/s1 |
| InChIKey | RLUQONXRLARYKA-SANMLTNESA-N |
| XLogP | 4.34 |
| TPSA | 163.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.03 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|