C31H34N7O7P — CID 89047996
2-dimethoxyphosphorylethyl N-[4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]carbamate (PubChem CID 89047996) has the molecular formula C31H34N7O7P and a molecular weight of 647.63 g/mol. Its IUPAC name is 2-dimethoxyphosphorylethyl N-[4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]carbamate.
| Compound Name | 2-dimethoxyphosphorylethyl N-[4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 89047996 |
| Molecular Formula | C31H34N7O7P |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | 2-dimethoxyphosphorylethyl N-[4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]carbamate |
| SMILES | COP(=O)(CCOC(=O)Nc1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)/C=C/c2cc(C)ccc2-n2cnnn2)cc1)OC |
| InChI | InChI=1S/C31H34N7O7P/c1-22-9-15-28(38-21-32-36-37-38)24(19-22)10-16-29(39)35-27(20-23-7-5-4-6-8-23)30(40)33-25-11-13-26(14-12-25)34-31(41)45-17-18-46(42,43-2)44-3/h4-16,19,21,27H,17-18,20H2,1-3H3,(H,33,40)(H,34,41)(H,35,39)/b16-10+/t27-/m0/s1 |
| InChIKey | PUESFVBRHQXXQT-YOUPSONNSA-N |
| XLogP | 4.38 |
| TPSA | 175.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|