C31H33FN7O7P — CID 89048078
2-dimethoxyphosphorylethyl N-[2-fluoro-4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]carbamate (PubChem CID 89048078) has the molecular formula C31H33FN7O7P and a molecular weight of 665.62 g/mol. Its IUPAC name is 2-dimethoxyphosphorylethyl N-[2-fluoro-4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]carbamate.
| Compound Name | 2-dimethoxyphosphorylethyl N-[2-fluoro-4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 89048078 |
| Molecular Formula | C31H33FN7O7P |
| Molecular Weight | 665.62 g/mol |
| Exact Mass | 665.22 |
| IUPAC Name | 2-dimethoxyphosphorylethyl N-[2-fluoro-4-[[(2S)-2-[[(E)-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]carbamate |
| SMILES | COP(=O)(CCOC(=O)Nc1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)/C=C/c2cc(C)ccc2-n2cnnn2)cc1F)OC |
| InChI | InChI=1S/C31H33FN7O7P/c1-21-9-13-28(39-20-33-37-38-39)23(17-21)10-14-29(40)35-27(18-22-7-5-4-6-8-22)30(41)34-24-11-12-26(25(32)19-24)36-31(42)46-15-16-47(43,44-2)45-3/h4-14,17,19-20,27H,15-16,18H2,1-3H3,(H,34,41)(H,35,40)(H,36,42)/b14-10+/t27-/m0/s1 |
| InChIKey | VILAPCZVFVERJP-UBRULYAKSA-N |
| XLogP | 4.52 |
| TPSA | 175.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|