C30H27ClFN7O7 — CID 175514042
4-[[2-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-[4-(2-methoxyethoxycarbonylamino)phenyl]propanoyl]amino]benzoic acid (PubChem CID 175514042) has the molecular formula C30H27ClFN7O7 and a molecular weight of 652.04 g/mol. Its IUPAC name is 4-[[2-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-[4-(2-methoxyethoxycarbonylamino)phenyl]propanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-[4-(2-methoxyethoxycarbonylamino)phenyl]propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175514042 |
| Molecular Formula | C30H27ClFN7O7 |
| Molecular Weight | 652.04 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | 4-[[2-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-[4-(2-methoxyethoxycarbonylamino)phenyl]propanoyl]amino]benzoic acid |
| SMILES | COCCOC(=O)Nc1ccc(CC(NC(=O)/C=C/c2c(-n3cnnn3)ccc(Cl)c2F)C(=O)Nc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H27ClFN7O7/c1-45-14-15-46-30(44)35-21-6-2-18(3-7-21)16-24(28(41)34-20-8-4-19(5-9-20)29(42)43)36-26(40)13-10-22-25(39-17-33-37-38-39)12-11-23(31)27(22)32/h2-13,17,24H,14-16H2,1H3,(H,34,41)(H,35,44)(H,36,40)(H,42,43)/b13-10+ |
| InChIKey | XZOCAVLBLNLWMY-JLHYYAGUSA-N |
| XLogP | 3.73 |
| TPSA | 186.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.04 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|