C28H23ClFN5O4 — CID 161256184
methyl 4-[(3S)-3-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-2-oxo-4-phenylbutyl]benzoate (PubChem CID 161256184) has the molecular formula C28H23ClFN5O4 and a molecular weight of 547.97 g/mol. Its IUPAC name is methyl 4-[(3S)-3-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-2-oxo-4-phenylbutyl]benzoate.
| Compound Name | methyl 4-[(3S)-3-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-2-oxo-4-phenylbutyl]benzoate |
|---|---|
| PubChem CID | 161256184 |
| Molecular Formula | C28H23ClFN5O4 |
| Molecular Weight | 547.97 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | methyl 4-[(3S)-3-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-2-oxo-4-phenylbutyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(=O)[C@H](Cc2ccccc2)NC(=O)/C=C/c2c(-n3cnnn3)ccc(Cl)c2F)cc1 |
| InChI | InChI=1S/C28H23ClFN5O4/c1-39-28(38)20-9-7-19(8-10-20)16-25(36)23(15-18-5-3-2-4-6-18)32-26(37)14-11-21-24(35-17-31-33-34-35)13-12-22(29)27(21)30/h2-14,17,23H,15-16H2,1H3,(H,32,37)/b14-11+/t23-/m0/s1 |
| InChIKey | SCMNFDSEWZNIQI-UDFXALJUSA-N |
| XLogP | 3.79 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.97 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|