C32H32ClN7O3 — CID 160895726
(E)-N-[(2S)-4-[4-(4-acetylpiperazin-1-yl)phenyl]-3-oxo-1-phenylbutan-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 160895726) has the molecular formula C32H32ClN7O3 and a molecular weight of 598.11 g/mol. Its IUPAC name is (E)-N-[(2S)-4-[4-(4-acetylpiperazin-1-yl)phenyl]-3-oxo-1-phenylbutan-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(2S)-4-[4-(4-acetylpiperazin-1-yl)phenyl]-3-oxo-1-phenylbutan-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 160895726 |
| Molecular Formula | C32H32ClN7O3 |
| Molecular Weight | 598.11 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | (E)-N-[(2S)-4-[4-(4-acetylpiperazin-1-yl)phenyl]-3-oxo-1-phenylbutan-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | CC(=O)N1CCN(c2ccc(CC(=O)[C@H](Cc3ccccc3)NC(=O)/C=C/c3cc(Cl)ccc3-n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C32H32ClN7O3/c1-23(41)38-15-17-39(18-16-38)28-11-7-25(8-12-28)20-31(42)29(19-24-5-3-2-4-6-24)35-32(43)14-9-26-21-27(33)10-13-30(26)40-22-34-36-37-40/h2-14,21-22,29H,15-20H2,1H3,(H,35,43)/b14-9+/t29-/m0/s1 |
| InChIKey | KROCZDAVMUUGCT-PTIDKISKSA-N |
| XLogP | 3.54 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.11 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|