C31H31ClN6O3S — CID 160686051
(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-[(2S)-4-[4-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)phenyl]-3-oxo-1-phenylbutan-2-yl]prop-2-enamide (PubChem CID 160686051) has the molecular formula C31H31ClN6O3S and a molecular weight of 603.15 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-[(2S)-4-[4-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)phenyl]-3-oxo-1-phenylbutan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-[(2S)-4-[4-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)phenyl]-3-oxo-1-phenylbutan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 160686051 |
| Molecular Formula | C31H31ClN6O3S |
| Molecular Weight | 603.15 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-[(2S)-4-[4-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)phenyl]-3-oxo-1-phenylbutan-2-yl]prop-2-enamide |
| SMILES | C=S1(=O)CCN(c2ccc(CC(=O)[C@H](Cc3ccccc3)NC(=O)/C=C/c3cc(Cl)ccc3-n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C31H31ClN6O3S/c1-42(41)17-15-37(16-18-42)27-11-7-24(8-12-27)20-30(39)28(19-23-5-3-2-4-6-23)34-31(40)14-9-25-21-26(32)10-13-29(25)38-22-33-35-36-38/h2-14,21-22,28H,1,15-20H2,(H,34,40)/b14-9+/t28-/m0/s1 |
| InChIKey | AGRFYIMJHVOSCW-CWBDRXANSA-N |
| XLogP | 3.40 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|