C11H8ClFN4O2 — CID 175513995
methyl 3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoate (PubChem CID 175513995) has the molecular formula C11H8ClFN4O2 and a molecular weight of 282.66 g/mol. Its IUPAC name is methyl 3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 175513995 |
| Molecular Formula | C11H8ClFN4O2 |
| Molecular Weight | 282.66 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | methyl 3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1c(-n2cnnn2)ccc(Cl)c1F |
| InChI | InChI=1S/C11H8ClFN4O2/c1-19-10(18)5-2-7-9(17-6-14-15-16-17)4-3-8(12)11(7)13/h2-6H,1H3 |
| InChIKey | OCXDIDPOYOAWPE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.66 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|