C31H32ClN7O4 — CID 25167020
diethylaminomethyl 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]benzoate (PubChem CID 25167020) has the molecular formula C31H32ClN7O4 and a molecular weight of 602.10 g/mol. Its IUPAC name is diethylaminomethyl 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]benzoate.
| Compound Name | diethylaminomethyl 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 25167020 |
| Molecular Formula | C31H32ClN7O4 |
| Molecular Weight | 602.10 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | diethylaminomethyl 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]benzoate |
| SMILES | CCN(CC)COC(=O)c1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)/C=C/c2cc(Cl)ccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C31H32ClN7O4/c1-3-38(4-2)21-43-31(42)23-10-14-26(15-11-23)34-30(41)27(18-22-8-6-5-7-9-22)35-29(40)17-12-24-19-25(32)13-16-28(24)39-20-33-36-37-39/h5-17,19-20,27H,3-4,18,21H2,1-2H3,(H,34,41)(H,35,40)/b17-12+/t27-/m0/s1 |
| InChIKey | HKCNSKNQCCAENC-YWCPMHMZSA-N |
| XLogP | 4.15 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.10 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|