C30H33ClN7O6P — CID 173106023
2-dimethoxyphosphorylethyl N-[4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-phenylpropyl]amino]phenyl]carbamate (PubChem CID 173106023) has the molecular formula C30H33ClN7O6P and a molecular weight of 654.06 g/mol. Its IUPAC name is 2-dimethoxyphosphorylethyl N-[4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-phenylpropyl]amino]phenyl]carbamate.
| Compound Name | 2-dimethoxyphosphorylethyl N-[4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-phenylpropyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 173106023 |
| Molecular Formula | C30H33ClN7O6P |
| Molecular Weight | 654.06 g/mol |
| Exact Mass | 653.19 |
| IUPAC Name | 2-dimethoxyphosphorylethyl N-[4-[[2-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-3-phenylpropyl]amino]phenyl]carbamate |
| SMILES | COP(=O)(CCOC(=O)Nc1ccc(NCC(Cc2ccccc2)NC(=O)C=Cc2cc(Cl)ccc2-n2cnnn2)cc1)OC |
| InChI | InChI=1S/C30H33ClN7O6P/c1-42-45(41,43-2)17-16-44-30(40)35-26-12-10-25(11-13-26)32-20-27(18-22-6-4-3-5-7-22)34-29(39)15-8-23-19-24(31)9-14-28(23)38-21-33-36-37-38/h3-15,19,21,27,32H,16-18,20H2,1-2H3,(H,34,39)(H,35,40) |
| InChIKey | YTXZJMKJPRXIEY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 158.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.06 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|