C27H25ClN6O3 — CID 68735393
4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-phenylbutyl]amino]benzoic acid (PubChem CID 68735393) has the molecular formula C27H25ClN6O3 and a molecular weight of 516.99 g/mol. Its IUPAC name is 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-phenylbutyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-phenylbutyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68735393 |
| Molecular Formula | C27H25ClN6O3 |
| Molecular Weight | 516.99 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-phenylbutyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1-n1cnnn1)N[C@@H](CCc1ccccc1)CNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H25ClN6O3/c28-22-10-14-25(34-18-30-32-33-34)21(16-22)9-15-26(35)31-24(11-6-19-4-2-1-3-5-19)17-29-23-12-7-20(8-13-23)27(36)37/h1-5,7-10,12-16,18,24,29H,6,11,17H2,(H,31,35)(H,36,37)/b15-9+/t24-/m0/s1 |
| InChIKey | VZMOGBDVKQXMMJ-RGCCYVKUSA-N |
| XLogP | 4.26 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.99 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|