C32H31ClN8O5 — CID 166636491
4-[[(2S)-4-(4-benzylpiperazin-1-yl)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-oxobutanoyl]amino]benzoic acid (PubChem CID 166636491) has the molecular formula C32H31ClN8O5 and a molecular weight of 643.10 g/mol. Its IUPAC name is 4-[[(2S)-4-(4-benzylpiperazin-1-yl)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-oxobutanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-4-(4-benzylpiperazin-1-yl)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 166636491 |
| Molecular Formula | C32H31ClN8O5 |
| Molecular Weight | 643.10 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | 4-[[(2S)-4-(4-benzylpiperazin-1-yl)-2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-oxobutanoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1-n1cnnn1)N[C@@H](CC(=O)N1CCN(Cc2ccccc2)CC1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H31ClN8O5/c33-25-9-12-28(41-21-34-37-38-41)24(18-25)8-13-29(42)36-27(31(44)35-26-10-6-23(7-11-26)32(45)46)19-30(43)40-16-14-39(15-17-40)20-22-4-2-1-3-5-22/h1-13,18,21,27H,14-17,19-20H2,(H,35,44)(H,36,42)(H,45,46)/b13-8+/t27-/m0/s1 |
| InChIKey | QIZADITWMZMFLB-MJZVOSTQSA-N |
| XLogP | 2.89 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.10 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|