C22H23ClN6O3S — CID 68736462
4-[[2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-methylsulfanylbutyl]amino]benzoic acid (PubChem CID 68736462) has the molecular formula C22H23ClN6O3S and a molecular weight of 486.99 g/mol. Its IUPAC name is 4-[[2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-methylsulfanylbutyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-methylsulfanylbutyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68736462 |
| Molecular Formula | C22H23ClN6O3S |
| Molecular Weight | 486.99 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 4-[[2-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-4-methylsulfanylbutyl]amino]benzoic acid |
| SMILES | CSCCC(CNc1ccc(C(=O)O)cc1)NC(=O)/C=C/c1cc(Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C22H23ClN6O3S/c1-33-11-10-19(13-24-18-6-2-15(3-7-18)22(31)32)26-21(30)9-4-16-12-17(23)5-8-20(16)29-14-25-27-28-29/h2-9,12,14,19,24H,10-11,13H2,1H3,(H,26,30)(H,31,32)/b9-4+ |
| InChIKey | XDKWYBQONBMNCR-RUDMXATFSA-N |
| XLogP | 3.38 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.99 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|