C16H20ClN5O — CID 138492682
(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-hexan-3-ylprop-2-enamide (PubChem CID 138492682) has the molecular formula C16H20ClN5O and a molecular weight of 333.82 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-hexan-3-ylprop-2-enamide.
| Compound Name | (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-hexan-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 138492682 |
| Molecular Formula | C16H20ClN5O |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-hexan-3-ylprop-2-enamide |
| SMILES | CCCC(CC)NC(=O)/C=C/c1cc(Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C16H20ClN5O/c1-3-5-14(4-2)19-16(23)9-6-12-10-13(17)7-8-15(12)22-11-18-20-21-22/h6-11,14H,3-5H2,1-2H3,(H,19,23)/b9-6+ |
| InChIKey | RSHIUGWNVKVZQY-RMKNXTFCSA-N |
| XLogP | 3.02 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|