C25H25Cl2N7O3 — CID 140675240
N-(3-chlorophenyl)-1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4-morpholin-4-ylpyrrolidine-2-carboxamide (PubChem CID 140675240) has the molecular formula C25H25Cl2N7O3 and a molecular weight of 542.43 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4-morpholin-4-ylpyrrolidine-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4-morpholin-4-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140675240 |
| Molecular Formula | C25H25Cl2N7O3 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | N-(3-chlorophenyl)-1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4-morpholin-4-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C1CC(N2CCOCC2)CN1C(=O)/C=C/c1cc(Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C25H25Cl2N7O3/c26-18-2-1-3-20(13-18)29-25(36)23-14-21(32-8-10-37-11-9-32)15-33(23)24(35)7-4-17-12-19(27)5-6-22(17)34-16-28-30-31-34/h1-7,12-13,16,21,23H,8-11,14-15H2,(H,29,36)/b7-4+ |
| InChIKey | ZKNANUXAHRWZSG-QPJJXVBHSA-N |
| XLogP | 2.92 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|