C24H25ClN8O3 — CID 123902233
1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4-morpholin-4-yl-N-pyridin-3-ylpyrrolidine-2-carboxamide (PubChem CID 123902233) has the molecular formula C24H25ClN8O3 and a molecular weight of 508.97 g/mol. Its IUPAC name is 1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4-morpholin-4-yl-N-pyridin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4-morpholin-4-yl-N-pyridin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123902233 |
| Molecular Formula | C24H25ClN8O3 |
| Molecular Weight | 508.97 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]-4-morpholin-4-yl-N-pyridin-3-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1CC(N2CCOCC2)CN1C(=O)C=Cc1cc(Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C24H25ClN8O3/c25-18-4-5-21(33-16-27-29-30-33)17(12-18)3-6-23(34)32-15-20(31-8-10-36-11-9-31)13-22(32)24(35)28-19-2-1-7-26-14-19/h1-7,12,14,16,20,22H,8-11,13,15H2,(H,28,35) |
| InChIKey | DUDBQYDGMDMPLX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.97 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|