C24H27BN4O4S — CID 123586965
1-(benzenesulfonyl)-5-(1-methylpyrazol-4-yl)-3-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 123586965) has the molecular formula C24H27BN4O4S and a molecular weight of 478.38 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-(1-methylpyrazol-4-yl)-3-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-5-(1-methylpyrazol-4-yl)-3-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123586965 |
| Molecular Formula | C24H27BN4O4S |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-(benzenesulfonyl)-5-(1-methylpyrazol-4-yl)-3-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | Cn1cc(-c2cnc3c(c2)c(B2OC(C)(C)CC(C)(C)O2)cn3S(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C24H27BN4O4S/c1-23(2)16-24(3,4)33-25(32-23)21-15-29(34(30,31)19-9-7-6-8-10-19)22-20(21)11-17(12-26-22)18-13-27-28(5)14-18/h6-15H,16H2,1-5H3 |
| InChIKey | ZOUTVQIZFQKFQW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|