C12H19N — CID 123587669
2-cyclohex-2-en-1-ylcyclohex-3-en-1-amine (PubChem CID 123587669) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-ylcyclohex-3-en-1-amine.
| Compound Name | 2-cyclohex-2-en-1-ylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 123587669 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-cyclohex-2-en-1-ylcyclohex-3-en-1-amine |
| SMILES | NC1CCC=CC1C1C=CCCC1 |
| InChI | InChI=1S/C12H19N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h2,4,6,8,10-12H,1,3,5,7,9,13H2 |
| InChIKey | JHPVWZTUXRHYAI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|