C17H27BNO3 — CID 123588156
CID 123588156 (PubChem CID 123588156) has the molecular formula C17H27BNO3 and a molecular weight of 304.22 g/mol.
| Compound Name | CID 123588156 |
|---|---|
| PubChem CID | 123588156 |
| Molecular Formula | C17H27BNO3 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | — |
| SMILES | CC1c2ccc([B]OC(C)(C)C(C)(C)O)cc2OC(N)C1C |
| InChI | InChI=1S/C17H27BNO3/c1-10-11(2)15(19)21-14-9-12(7-8-13(10)14)18-22-17(5,6)16(3,4)20/h7-11,15,20H,19H2,1-6H3 |
| InChIKey | MFKBJKVCLQNPEN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|