C6H9FN2 — CID 123588566
(E)-3-fluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine (PubChem CID 123588566) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is (E)-3-fluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine.
| Compound Name | (E)-3-fluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine |
|---|---|
| PubChem CID | 123588566 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (E)-3-fluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine |
| SMILES | C=N/C=C(F)\C(C)=N\C |
| InChI | InChI=1S/C6H9FN2/c1-5(9-3)6(7)4-8-2/h4H,2H2,1,3H3/b6-4+,9-5+ |
| InChIKey | HAUJYZBTGSICKY-REZHQCRGSA-N |
| XLogP | 1.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|