About (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine
(Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine (PubChem CID 163443571) has the molecular formula C6H8F2N2
and a molecular weight of 146.14 g/mol. Its IUPAC name is (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine.
Molecular Properties
| Compound Name | (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine |
| PubChem CID | 163443571 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine |
| SMILES | C=N/C(F)=C(F)\C(C)=N\C |
| InChI | InChI=1S/C6H8F2N2/c1-4(9-2)5(7)6(8)10-3/h3H2,1-2H3/b6-5+,9-4+ |
| InChIKey | BAPMWCKJDRKXFI-BZNITXMSSA-N |
| XLogP | 1.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine?
The IUPAC name of (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine (CID 163443571) is (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine.
What is the SMILES notation for (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine?
The canonical SMILES for (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine is C=N/C(F)=C(F)\C(C)=N\C.
What is the InChIKey of (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine?
The InChIKey is BAPMWCKJDRKXFI-BZNITXMSSA-N. The full InChI is InChI=1S/C6H8F2N2/c1-4(9-2)5(7)6(8)10-3/h3H2,1-2H3/b6-5+,9-4+.
What are the key properties of (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine?
(Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine has a molecular weight of 146.14 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-difluoro-2-N-methyl-4-N-methylidenebut-3-ene-2,4-diimine is sourced from PubChem (CID 163443571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).